C11H9Cl2N3O2 — CID 17386070
1-[(2,3-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole (PubChem CID 17386070) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole |
|---|---|
| PubChem CID | 17386070 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-7-5-10(16(17)18)14-15(7)6-8-3-2-4-9(12)11(8)13/h2-5H,6H2,1H3 |
| InChIKey | ULNZVCHUTCYEEM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|