C20H17ClFN7O4 — CID 19442760
N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442760) has the molecular formula C20H17ClFN7O4 and a molecular weight of 473.85 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442760 |
| Molecular Formula | C20H17ClFN7O4 |
| Molecular Weight | 473.85 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2cc(C)n(Cc3c(F)cccc3Cl)n2)c1Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H17ClFN7O4/c1-11-8-17(24-28(11)10-14-15(21)4-3-5-16(14)22)23-20(30)19-13(12(2)33-26-19)9-27-7-6-18(25-27)29(31)32/h3-8H,9-10H2,1-2H3,(H,23,24,30) |
| InChIKey | MFYDASHFZQHCSZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|