C19H15Cl2N7O4 — CID 19442744
N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442744) has the molecular formula C19H15Cl2N7O4 and a molecular weight of 476.28 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442744 |
| Molecular Formula | C19H15Cl2N7O4 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2ccn(Cc3c(Cl)cccc3Cl)n2)c1Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H15Cl2N7O4/c1-11-12(9-27-8-6-17(24-27)28(30)31)18(25-32-11)19(29)22-16-5-7-26(23-16)10-13-14(20)3-2-4-15(13)21/h2-8H,9-10H2,1H3,(H,22,23,29) |
| InChIKey | IQNGGLBTOYPEEW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|