C17H11Cl2N5O5 — CID 19407002
N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dinitrobenzamide (PubChem CID 19407002) has the molecular formula C17H11Cl2N5O5 and a molecular weight of 436.21 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 19407002 |
| Molecular Formula | C17H11Cl2N5O5 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ccn(Cc2c(Cl)cccc2Cl)n1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11Cl2N5O5/c18-14-2-1-3-15(19)13(14)9-22-5-4-16(21-22)20-17(25)10-6-11(23(26)27)8-12(7-10)24(28)29/h1-8H,9H2,(H,20,21,25) |
| InChIKey | ULXXDPLSTLWHEC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|