C21H19Cl2N7O4 — CID 19442615
N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442615) has the molecular formula C21H19Cl2N7O4 and a molecular weight of 504.33 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442615 |
| Molecular Formula | C21H19Cl2N7O4 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2cc(C)n(Cc3ccc(Cl)cc3Cl)n2)c1Cn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H19Cl2N7O4/c1-11-6-18(25-28(11)9-14-4-5-15(22)8-17(14)23)24-21(31)20-16(13(3)34-27-20)10-29-12(2)7-19(26-29)30(32)33/h4-8H,9-10H2,1-3H3,(H,24,25,31) |
| InChIKey | KTXHSIIOTWGDQA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|