C20H17BrClN7O4 — CID 19442633
N-[1-[(4-bromophenyl)methyl]-4-chloropyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442633) has the molecular formula C20H17BrClN7O4 and a molecular weight of 534.76 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)methyl]-4-chloropyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-[(4-bromophenyl)methyl]-4-chloropyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442633 |
| Molecular Formula | C20H17BrClN7O4 |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | N-[1-[(4-bromophenyl)methyl]-4-chloropyrazol-3-yl]-5-methyl-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2nn(Cc3ccc(Br)cc3)cc2Cl)c1Cn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C20H17BrClN7O4/c1-11-7-17(29(31)32)24-28(11)9-15-12(2)33-26-18(15)20(30)23-19-16(22)10-27(25-19)8-13-3-5-14(21)6-4-13/h3-7,10H,8-9H2,1-2H3,(H,23,25,30) |
| InChIKey | BYLULKJZPIRSGU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|