C20H18ClN7O4 — CID 19442457
N-[4-chloro-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442457) has the molecular formula C20H18ClN7O4 and a molecular weight of 455.86 g/mol. Its IUPAC name is N-[4-chloro-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-chloro-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442457 |
| Molecular Formula | C20H18ClN7O4 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[4-chloro-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(Cn2cc(Cl)c(NC(=O)c3noc(C)c3Cn3cc([N+](=O)[O-])cn3)n2)cc1 |
| InChI | InChI=1S/C20H18ClN7O4/c1-12-3-5-14(6-4-12)8-27-11-17(21)19(24-27)23-20(29)18-16(13(2)32-25-18)10-26-9-15(7-22-26)28(30)31/h3-7,9,11H,8,10H2,1-2H3,(H,23,24,29) |
| InChIKey | DARDVUMTFNZOSF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|