C22H18ClN5O4S — CID 19442009
4-[(4-chloropyrazol-1-yl)methyl]-5-methyl-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442009) has the molecular formula C22H18ClN5O4S and a molecular weight of 483.94 g/mol. Its IUPAC name is 4-[(4-chloropyrazol-1-yl)methyl]-5-methyl-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[(4-chloropyrazol-1-yl)methyl]-5-methyl-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442009 |
| Molecular Formula | C22H18ClN5O4S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 4-[(4-chloropyrazol-1-yl)methyl]-5-methyl-N-[3-(4-methylphenyl)sulfanyl-5-nitrophenyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(Sc2cc(NC(=O)c3noc(C)c3Cn3cc(Cl)cn3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H18ClN5O4S/c1-13-3-5-18(6-4-13)33-19-8-16(7-17(9-19)28(30)31)25-22(29)21-20(14(2)32-26-21)12-27-11-15(23)10-24-27/h3-11H,12H2,1-2H3,(H,25,29) |
| InChIKey | IGVVQCYJYOSWLQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|