C23H19N7O4 — CID 19442429
5-methyl-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442429) has the molecular formula C23H19N7O4 and a molecular weight of 457.45 g/mol. Its IUPAC name is 5-methyl-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442429 |
| Molecular Formula | C23H19N7O4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 5-methyl-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2cnn(Cc3cccc4ccccc34)c2)c1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C23H19N7O4/c1-15-21(14-29-13-19(10-25-29)30(32)33)22(27-34-15)23(31)26-18-9-24-28(12-18)11-17-7-4-6-16-5-2-3-8-20(16)17/h2-10,12-13H,11,14H2,1H3,(H,26,31) |
| InChIKey | LIGIBGBHNKAKNX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|