C16H12F3N5O4 — CID 19442422
5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442422) has the molecular formula C16H12F3N5O4 and a molecular weight of 395.30 g/mol. Its IUPAC name is 5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442422 |
| Molecular Formula | C16H12F3N5O4 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-N-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2ccc(C(F)(F)F)cc2)c1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H12F3N5O4/c1-9-13(8-23-7-12(6-20-23)24(26)27)14(22-28-9)15(25)21-11-4-2-10(3-5-11)16(17,18)19/h2-7H,8H2,1H3,(H,21,25) |
| InChIKey | BNABYLBMWCGXAD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|