C19H19N5O4 — CID 19442438
(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone (PubChem CID 19442438) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone.
| Compound Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 19442438 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[5-methyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)c1noc(C)c1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C19H19N5O4/c1-12-5-6-17-14(8-12)4-3-7-23(17)19(25)18-16(13(2)28-21-18)11-22-10-15(9-20-22)24(26)27/h5-6,8-10H,3-4,7,11H2,1-2H3 |
| InChIKey | ANVKEDMELVPXDK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 107.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|