C15H18N4O3 — CID 111496299
1-(6-methyl-2,3-dihydroindol-1-yl)-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 111496299) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-(6-methyl-2,3-dihydroindol-1-yl)-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(6-methyl-2,3-dihydroindol-1-yl)-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 111496299 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-(6-methyl-2,3-dihydroindol-1-yl)-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | Cc1ccc2c(c1)N(CC(O)Cn1cc([N+](=O)[O-])cn1)CC2 |
| InChI | InChI=1S/C15H18N4O3/c1-11-2-3-12-4-5-17(15(12)6-11)9-14(20)10-18-8-13(7-16-18)19(21)22/h2-3,6-8,14,20H,4-5,9-10H2,1H3 |
| InChIKey | NDQVIMHXVNDLBD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|