C12H17N5O3 — CID 91662465
1-(4-nitropyrazol-1-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propan-2-ol (PubChem CID 91662465) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(4-nitropyrazol-1-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 91662465 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-3-(3,4,5-trimethylpyrazol-1-yl)propan-2-ol |
| SMILES | Cc1nn(CC(O)Cn2cc([N+](=O)[O-])cn2)c(C)c1C |
| InChI | InChI=1S/C12H17N5O3/c1-8-9(2)14-16(10(8)3)7-12(18)6-15-5-11(4-13-15)17(19)20/h4-5,12,18H,6-7H2,1-3H3 |
| InChIKey | NOJCJMOISDTPGK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|