C15H18N4O4 — CID 98775320
(2R)-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 98775320) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 98775320 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2R)-1-[(2R)-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | C[C@@H]1CN(C[C@@H](O)Cn2cc([N+](=O)[O-])cn2)c2ccccc2O1 |
| InChI | InChI=1S/C15H18N4O4/c1-11-7-17(14-4-2-3-5-15(14)23-11)9-13(20)10-18-8-12(6-16-18)19(21)22/h2-6,8,11,13,20H,7,9-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | ZLLCHMBWSIMHGJ-DGCLKSJQSA-N |
| XLogP | 1.44 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|