C18H24N4O3 — CID 111476644
1-(4-nitropyrazol-1-yl)-3-(2-phenylazepan-1-yl)propan-2-ol (PubChem CID 111476644) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-3-(2-phenylazepan-1-yl)propan-2-ol.
| Compound Name | 1-(4-nitropyrazol-1-yl)-3-(2-phenylazepan-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 111476644 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-3-(2-phenylazepan-1-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CN2CCCCCC2c2ccccc2)c1 |
| InChI | InChI=1S/C18H24N4O3/c23-17(14-21-12-16(11-19-21)22(24)25)13-20-10-6-2-5-9-18(20)15-7-3-1-4-8-15/h1,3-4,7-8,11-12,17-18,23H,2,5-6,9-10,13-14H2 |
| InChIKey | AYYAODRUABSXAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|