C15H22N6O3 — CID 111565334
1-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 111565334) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 111565334 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | Cn1cc(CC2CCN(CC(O)Cn3cc([N+](=O)[O-])cn3)C2)cn1 |
| InChI | InChI=1S/C15H22N6O3/c1-18-7-13(5-16-18)4-12-2-3-19(8-12)10-15(22)11-20-9-14(6-17-20)21(23)24/h5-7,9,12,15,22H,2-4,8,10-11H2,1H3 |
| InChIKey | GWCMHXAAROSWIU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|