C19H27N5O4 — CID 154793764
1-[[2-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]phenyl]methylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 154793764) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[[2-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]phenyl]methylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-[[2-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]phenyl]methylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 154793764 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[[2-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]phenyl]methylamino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CNCc2ccccc2CN2CCCC2CO)c1 |
| InChI | InChI=1S/C19H27N5O4/c25-14-17-6-3-7-22(17)11-16-5-2-1-4-15(16)8-20-10-19(26)13-23-12-18(9-21-23)24(27)28/h1-2,4-5,9,12,17,19-20,25-26H,3,6-8,10-11,13-14H2 |
| InChIKey | BCSWLNQOWSGKDA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|