C12H20N4O4 — CID 61039617
1-(4-nitropyrazol-1-yl)-3-[2-(oxolan-2-yl)ethylamino]propan-2-ol (PubChem CID 61039617) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-3-[2-(oxolan-2-yl)ethylamino]propan-2-ol.
| Compound Name | 1-(4-nitropyrazol-1-yl)-3-[2-(oxolan-2-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 61039617 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-3-[2-(oxolan-2-yl)ethylamino]propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CNCCC2CCCO2)c1 |
| InChI | InChI=1S/C12H20N4O4/c17-11(7-13-4-3-12-2-1-5-20-12)9-15-8-10(6-14-15)16(18)19/h6,8,11-13,17H,1-5,7,9H2 |
| InChIKey | DKWXZPXETKEZEP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|