C14H19N5O3S — CID 71854303
1-(4-nitropyrazol-1-yl)-3-(4-thiophen-2-ylpiperazin-1-yl)propan-2-ol (PubChem CID 71854303) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-3-(4-thiophen-2-ylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-(4-nitropyrazol-1-yl)-3-(4-thiophen-2-ylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 71854303 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-3-(4-thiophen-2-ylpiperazin-1-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CN2CCN(c3cccs3)CC2)c1 |
| InChI | InChI=1S/C14H19N5O3S/c20-13(11-18-9-12(8-15-18)19(21)22)10-16-3-5-17(6-4-16)14-2-1-7-23-14/h1-2,7-9,13,20H,3-6,10-11H2 |
| InChIKey | VUIMMNPEZJQKGP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|