C13H12F3N3O3 — CID 97243210
(2S)-1-(4-nitropyrazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 97243210) has the molecular formula C13H12F3N3O3 and a molecular weight of 315.25 g/mol. Its IUPAC name is (2S)-1-(4-nitropyrazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | (2S)-1-(4-nitropyrazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 97243210 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (2S)-1-(4-nitropyrazol-1-yl)-3-[4-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(C[C@@H](O)Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C13H12F3N3O3/c14-13(15,16)10-3-1-9(2-4-10)5-12(20)8-18-7-11(6-17-18)19(21)22/h1-4,6-7,12,20H,5,8H2/t12-/m0/s1 |
| InChIKey | JRXJDWXYGFVQSP-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|