C20H17N7O7 — CID 17084720
3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084720) has the molecular formula C20H17N7O7 and a molecular weight of 467.40 g/mol. Its IUPAC name is 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084720 |
| Molecular Formula | C20H17N7O7 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1noc(C(=O)NCCNC(=O)c2cc3ccccc3oc2=O)n1 |
| InChI | InChI=1S/C20H17N7O7/c1-11-8-16(27(31)32)24-26(11)10-15-23-19(34-25-15)18(29)22-7-6-21-17(28)13-9-12-4-2-3-5-14(12)33-20(13)30/h2-5,8-9H,6-7,10H2,1H3,(H,21,28)(H,22,29) |
| InChIKey | CWYFNDORYYQYTE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|