C19H15Cl3N4O4 — CID 17083534
3-(5-chloro-2-methoxyphenyl)-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083534) has the molecular formula C19H15Cl3N4O4 and a molecular weight of 469.71 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083534 |
| Molecular Formula | C19H15Cl3N4O4 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1noc(C(=O)NCCNC(=O)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H15Cl3N4O4/c1-29-15-5-3-11(20)9-12(15)16-25-19(30-26-16)18(28)24-7-6-23-17(27)10-2-4-13(21)14(22)8-10/h2-5,8-9H,6-7H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | NPBZCLLURZJCID-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|