C18H16ClN5O4 — CID 16765835
3-(5-chloro-2-methoxyphenyl)-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 16765835) has the molecular formula C18H16ClN5O4 and a molecular weight of 401.81 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 16765835 |
| Molecular Formula | C18H16ClN5O4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-N-[2-(pyridine-3-carbonylamino)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1noc(C(=O)NCCNC(=O)c2cccnc2)n1 |
| InChI | InChI=1S/C18H16ClN5O4/c1-27-14-5-4-12(19)9-13(14)15-23-18(28-24-15)17(26)22-8-7-21-16(25)11-3-2-6-20-10-11/h2-6,9-10H,7-8H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | YUTAUKGNIOPDFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|