C19H16Cl2N4O4 — CID 17083533
N-[2-[(2-chlorobenzoyl)amino]ethyl]-3-(5-chloro-2-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083533) has the molecular formula C19H16Cl2N4O4 and a molecular weight of 435.27 g/mol. Its IUPAC name is N-[2-[(2-chlorobenzoyl)amino]ethyl]-3-(5-chloro-2-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-3-(5-chloro-2-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083533 |
| Molecular Formula | C19H16Cl2N4O4 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-3-(5-chloro-2-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1noc(C(=O)NCCNC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C19H16Cl2N4O4/c1-28-15-7-6-11(20)10-13(15)16-24-19(29-25-16)18(27)23-9-8-22-17(26)12-4-2-3-5-14(12)21/h2-7,10H,8-9H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | BKSCPLQZSSOODF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|