C19H16ClN5O6 — CID 17083762
N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083762) has the molecular formula C19H16ClN5O6 and a molecular weight of 445.82 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083762 |
| Molecular Formula | C19H16ClN5O6 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]-3-(3-nitrophenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCNC(=O)c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C19H16ClN5O6/c1-30-15-6-5-12(20)10-14(15)17(26)21-7-8-22-18(27)19-23-16(24-31-19)11-3-2-4-13(9-11)25(28)29/h2-6,9-10H,7-8H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | UDVSBYPUOOWITJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|