C15H11Cl2N5O — CID 9421628
N-(3-chlorophenyl)-2-[5-(4-chlorophenyl)tetrazol-1-yl]acetamide (PubChem CID 9421628) has the molecular formula C15H11Cl2N5O and a molecular weight of 348.19 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[5-(4-chlorophenyl)tetrazol-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[5-(4-chlorophenyl)tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 9421628 |
| Molecular Formula | C15H11Cl2N5O |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-(3-chlorophenyl)-2-[5-(4-chlorophenyl)tetrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nnnc1-c1ccc(Cl)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N5O/c16-11-6-4-10(5-7-11)15-19-20-21-22(15)9-14(23)18-13-3-1-2-12(17)8-13/h1-8H,9H2,(H,18,23) |
| InChIKey | JPLICVUUNMFZQQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |