C15H11Cl2N5OS — CID 1328619
N-(3-chlorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 1328619) has the molecular formula C15H11Cl2N5OS and a molecular weight of 380.26 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1328619 |
| Molecular Formula | C15H11Cl2N5OS |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-(3-chlorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N5OS/c16-10-4-6-13(7-5-10)22-15(19-20-21-22)24-9-14(23)18-12-3-1-2-11(17)8-12/h1-8H,9H2,(H,18,23) |
| InChIKey | AEFQOZDWBJZVJT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |