C16H11ClF3N5OS — CID 1026931
2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 1026931) has the molecular formula C16H11ClF3N5OS and a molecular weight of 413.81 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1026931 |
| Molecular Formula | C16H11ClF3N5OS |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc(Cl)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF3N5OS/c17-11-4-2-6-13(8-11)25-15(22-23-24-25)27-9-14(26)21-12-5-1-3-10(7-12)16(18,19)20/h1-8H,9H2,(H,21,26) |
| InChIKey | HAEFVGXQNAAGOD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |