C15H11ClFN5OS — CID 7562846
N-(3-chlorophenyl)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 7562846) has the molecular formula C15H11ClFN5OS and a molecular weight of 363.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7562846 |
| Molecular Formula | C15H11ClFN5OS |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc(F)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11ClFN5OS/c16-10-3-1-5-12(7-10)18-14(23)9-24-15-19-20-21-22(15)13-6-2-4-11(17)8-13/h1-8H,9H2,(H,18,23) |
| InChIKey | UQSBRKDRROEMJV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |