C20H21FN6OS — CID 9380486
2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 9380486) has the molecular formula C20H21FN6OS and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 9380486 |
| Molecular Formula | C20H21FN6OS |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2nnnn2-c2cccc(F)c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C20H21FN6OS/c1-14-11-16(7-8-18(14)26-9-2-3-10-26)22-19(28)13-29-20-23-24-25-27(20)17-6-4-5-15(21)12-17/h4-8,11-12H,2-3,9-10,13H2,1H3,(H,22,28) |
| InChIKey | BNVHJDDKDMVOBW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|