C22H26N6OS — CID 7225097
2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 7225097) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7225097 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)Nc2ccc(N3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H26N6OS/c1-16-6-11-20(17(2)14-16)28-22(24-25-26-28)30-15-21(29)23-18-7-9-19(10-8-18)27-12-4-3-5-13-27/h6-11,14H,3-5,12-13,15H2,1-2H3,(H,23,29) |
| InChIKey | JTDLSCPTIGADSZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|