C19H18FN5O3S — CID 7563027
propan-2-yl 4-[[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate (PubChem CID 7563027) has the molecular formula C19H18FN5O3S and a molecular weight of 415.45 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7563027 |
| Molecular Formula | C19H18FN5O3S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | propan-2-yl 4-[[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)CSc2nnnn2-c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H18FN5O3S/c1-12(2)28-18(27)13-6-8-15(9-7-13)21-17(26)11-29-19-22-23-24-25(19)16-5-3-4-14(20)10-16/h3-10,12H,11H2,1-2H3,(H,21,26) |
| InChIKey | DLHASJMKNWFOPO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |