C15H13ClN6O3S2 — CID 27159868
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 27159868) has the molecular formula C15H13ClN6O3S2 and a molecular weight of 424.90 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 27159868 |
| Molecular Formula | C15H13ClN6O3S2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CSc2nnnn2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H13ClN6O3S2/c16-10-4-6-12(7-5-10)22-15(19-20-21-22)26-9-14(23)18-11-2-1-3-13(8-11)27(17,24)25/h1-8H,9H2,(H,18,23)(H2,17,24,25) |
| InChIKey | ZLLWFSYRGVOJPU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |