C18H13ClN6O3S — CID 32787695
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 32787695) has the molecular formula C18H13ClN6O3S and a molecular weight of 428.86 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 32787695 |
| Molecular Formula | C18H13ClN6O3S |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CSc3nnnn3-c3ccc(Cl)cc3)cc2C1=O |
| InChI | InChI=1S/C18H13ClN6O3S/c1-24-16(27)13-7-4-11(8-14(13)17(24)28)20-15(26)9-29-18-21-22-23-25(18)12-5-2-10(19)3-6-12/h2-8H,9H2,1H3,(H,20,26) |
| InChIKey | ZKHBSQFMAQDEEE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|