C13H12F3IN2 — CID 79785518
4-iodo-3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole (PubChem CID 79785518) has the molecular formula C13H12F3IN2 and a molecular weight of 380.15 g/mol. Its IUPAC name is 4-iodo-3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole.
| Compound Name | 4-iodo-3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole |
|---|---|
| PubChem CID | 79785518 |
| Molecular Formula | C13H12F3IN2 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 4-iodo-3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole |
| SMILES | Cc1nn(Cc2cccc(C(F)(F)F)c2)c(C)c1I |
| InChI | InChI=1S/C13H12F3IN2/c1-8-12(17)9(2)19(18-8)7-10-4-3-5-11(6-10)13(14,15)16/h3-6H,7H2,1-2H3 |
| InChIKey | QUGOQJHSEFLSSY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|