C11H7Br2F3N2 — CID 114692714
3,5-dibromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole (PubChem CID 114692714) has the molecular formula C11H7Br2F3N2 and a molecular weight of 383.99 g/mol. Its IUPAC name is 3,5-dibromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole.
| Compound Name | 3,5-dibromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole |
|---|---|
| PubChem CID | 114692714 |
| Molecular Formula | C11H7Br2F3N2 |
| Molecular Weight | 383.99 g/mol |
| Exact Mass | 381.89 |
| IUPAC Name | 3,5-dibromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole |
| SMILES | FC(F)(F)c1cccc(Cn2nc(Br)cc2Br)c1 |
| InChI | InChI=1S/C11H7Br2F3N2/c12-9-5-10(13)18(17-9)6-7-2-1-3-8(4-7)11(14,15)16/h1-5H,6H2 |
| InChIKey | RURIQGGVHKABFP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |