C15H10BrF3N2 — CID 67186508
7-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole (PubChem CID 67186508) has the molecular formula C15H10BrF3N2 and a molecular weight of 355.16 g/mol. Its IUPAC name is 7-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole.
| Compound Name | 7-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole |
|---|---|
| PubChem CID | 67186508 |
| Molecular Formula | C15H10BrF3N2 |
| Molecular Weight | 355.16 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 7-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole |
| SMILES | FC(F)(F)c1cccc(Cn2cc3cccc(Br)c3n2)c1 |
| InChI | InChI=1S/C15H10BrF3N2/c16-13-6-2-4-11-9-21(20-14(11)13)8-10-3-1-5-12(7-10)15(17,18)19/h1-7,9H,8H2 |
| InChIKey | ITAUVGARILKHTB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.16 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |