C11H10F3N3O2S — CID 79001292
1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-4-sulfonamide (PubChem CID 79001292) has the molecular formula C11H10F3N3O2S and a molecular weight of 305.28 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 79001292 |
| Molecular Formula | C11H10F3N3O2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn(Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C11H10F3N3O2S/c12-11(13,14)9-3-1-2-8(4-9)6-17-7-10(5-16-17)20(15,18)19/h1-5,7H,6H2,(H2,15,18,19) |
| InChIKey | PKLVEFKOPFEYKS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |