C10H10ClN3O2S — CID 63278705
1-[(3-chlorophenyl)methyl]pyrazole-4-sulfonamide (PubChem CID 63278705) has the molecular formula C10H10ClN3O2S and a molecular weight of 271.73 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 63278705 |
| Molecular Formula | C10H10ClN3O2S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]pyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn(Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C10H10ClN3O2S/c11-9-3-1-2-8(4-9)6-14-7-10(5-13-14)17(12,15)16/h1-5,7H,6H2,(H2,12,15,16) |
| InChIKey | ZOTAGVBMKPFNGK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |