C16H13ClFN3O2S — CID 17022795
N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 17022795) has the molecular formula C16H13ClFN3O2S and a molecular weight of 365.82 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 17022795 |
| Molecular Formula | C16H13ClFN3O2S |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnn(Cc2cccc(Cl)c2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13ClFN3O2S/c17-13-3-1-2-12(8-13)10-21-11-15(9-19-21)20-24(22,23)16-6-4-14(18)5-7-16/h1-9,11,20H,10H2 |
| InChIKey | HFFSRVMTBSKXTO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |