C11H10F3N3 — CID 129205660
1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-amine (PubChem CID 129205660) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-amine.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-amine |
|---|---|
| PubChem CID | 129205660 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-amine |
| SMILES | Nc1cn(Cc2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C11H10F3N3/c12-11(13,14)9-3-1-2-8(4-9)5-17-6-10(15)16-7-17/h1-4,6-7H,5,15H2 |
| InChIKey | JYEDBLYAFFLRCM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |