C11H19IN2O — CID 112592599
4-iodo-3,5-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole (PubChem CID 112592599) has the molecular formula C11H19IN2O and a molecular weight of 322.19 g/mol. Its IUPAC name is 4-iodo-3,5-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole.
| Compound Name | 4-iodo-3,5-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole |
|---|---|
| PubChem CID | 112592599 |
| Molecular Formula | C11H19IN2O |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-iodo-3,5-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole |
| SMILES | Cc1nn(CCOC(C)(C)C)c(C)c1I |
| InChI | InChI=1S/C11H19IN2O/c1-8-10(12)9(2)14(13-8)6-7-15-11(3,4)5/h6-7H2,1-5H3 |
| InChIKey | UTDGJZUZCWTFIR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|