C13H25IN2O2Si — CID 170617962
[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-methylpyrazol-3-yl]methanol (PubChem CID 170617962) has the molecular formula C13H25IN2O2Si and a molecular weight of 396.35 g/mol. Its IUPAC name is [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-methylpyrazol-3-yl]methanol.
| Compound Name | [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-methylpyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 170617962 |
| Molecular Formula | C13H25IN2O2Si |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-methylpyrazol-3-yl]methanol |
| SMILES | Cc1c(I)c(CO)nn1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25IN2O2Si/c1-10-12(14)11(9-17)15-16(10)7-8-18-19(5,6)13(2,3)4/h17H,7-9H2,1-6H3 |
| InChIKey | ZSJYGUAXQZDARZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|