C17H32IN3O5SSi — CID 170618593
[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrazol-3-yl]methanol (PubChem CID 170618593) has the molecular formula C17H32IN3O5SSi and a molecular weight of 545.52 g/mol. Its IUPAC name is [2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrazol-3-yl]methanol.
| Compound Name | [2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 170618593 |
| Molecular Formula | C17H32IN3O5SSi |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | [2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrazol-3-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1nc(O[C@H]2CCN(S(C)(=O)=O)C2)c(I)c1CO |
| InChI | InChI=1S/C17H32IN3O5SSi/c1-17(2,3)28(5,6)25-10-9-21-14(12-22)15(18)16(19-21)26-13-7-8-20(11-13)27(4,23)24/h13,22H,7-12H2,1-6H3/t13-/m0/s1 |
| InChIKey | ZWTXFHXIPARBBR-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|