C15H29IN2O3Si — CID 174156310
[2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-ethoxy-4-iodopyrazol-3-yl]methanol (PubChem CID 174156310) has the molecular formula C15H29IN2O3Si and a molecular weight of 440.40 g/mol. Its IUPAC name is [2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-ethoxy-4-iodopyrazol-3-yl]methanol.
| Compound Name | [2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-ethoxy-4-iodopyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 174156310 |
| Molecular Formula | C15H29IN2O3Si |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-ethoxy-4-iodopyrazol-3-yl]methanol |
| SMILES | CCOc1nn(C(C)CO[Si](C)(C)C(C)(C)C)c(CO)c1I |
| InChI | InChI=1S/C15H29IN2O3Si/c1-8-20-14-13(16)12(9-19)18(17-14)11(2)10-21-22(6,7)15(3,4)5/h11,19H,8-10H2,1-7H3 |
| InChIKey | QVJJOXHCGFXXGY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|