C19H35IN2O4Si — CID 170618031
tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-iodo-3-propan-2-yloxypyrazol-1-yl]acetate (PubChem CID 170618031) has the molecular formula C19H35IN2O4Si and a molecular weight of 510.49 g/mol. Its IUPAC name is tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-iodo-3-propan-2-yloxypyrazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-iodo-3-propan-2-yloxypyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 170618031 |
| Molecular Formula | C19H35IN2O4Si |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-iodo-3-propan-2-yloxypyrazol-1-yl]acetate |
| SMILES | CC(C)Oc1nn(CC(=O)OC(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c1I |
| InChI | InChI=1S/C19H35IN2O4Si/c1-13(2)25-17-16(20)14(12-24-27(9,10)19(6,7)8)22(21-17)11-15(23)26-18(3,4)5/h13H,11-12H2,1-10H3 |
| InChIKey | DBRBBKOTKLUHGB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|