C11H18N2O3 — CID 134163721
tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 134163721) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate.
| Compound Name | tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 134163721 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | tert-butyl 2-(4-hydroxy-3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OC(C)(C)C)c(C)c1O |
| InChI | InChI=1S/C11H18N2O3/c1-7-10(15)8(2)13(12-7)6-9(14)16-11(3,4)5/h15H,6H2,1-5H3 |
| InChIKey | AYJPNMRVZZPYEX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |