C10H12Cl2N2O3 — CID 164914330
tert-butyl 2-(3,4-dichloro-6-oxopyridazin-1-yl)acetate (PubChem CID 164914330) has the molecular formula C10H12Cl2N2O3 and a molecular weight of 279.12 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dichloro-6-oxopyridazin-1-yl)acetate.
| Compound Name | tert-butyl 2-(3,4-dichloro-6-oxopyridazin-1-yl)acetate |
|---|---|
| PubChem CID | 164914330 |
| Molecular Formula | C10H12Cl2N2O3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | tert-butyl 2-(3,4-dichloro-6-oxopyridazin-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1nc(Cl)c(Cl)cc1=O |
| InChI | InChI=1S/C10H12Cl2N2O3/c1-10(2,3)17-8(16)5-14-7(15)4-6(11)9(12)13-14/h4H,5H2,1-3H3 |
| InChIKey | OWZPPZAHUWHXSV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |