C15H17IN2O3 — CID 178100346
tert-butyl 2-(3-iodo-5,7-dihydrofuro[3,4-f]indazol-1-yl)acetate (PubChem CID 178100346) has the molecular formula C15H17IN2O3 and a molecular weight of 400.22 g/mol. Its IUPAC name is tert-butyl 2-(3-iodo-5,7-dihydrofuro[3,4-f]indazol-1-yl)acetate.
| Compound Name | tert-butyl 2-(3-iodo-5,7-dihydrofuro[3,4-f]indazol-1-yl)acetate |
|---|---|
| PubChem CID | 178100346 |
| Molecular Formula | C15H17IN2O3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | tert-butyl 2-(3-iodo-5,7-dihydrofuro[3,4-f]indazol-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1nc(I)c2cc3c(cc21)COC3 |
| InChI | InChI=1S/C15H17IN2O3/c1-15(2,3)21-13(19)6-18-12-5-10-8-20-7-9(10)4-11(12)14(16)17-18/h4-5H,6-8H2,1-3H3 |
| InChIKey | OKRYZSNEKGBSII-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|