C15H16INO3 — CID 176913514
tert-butyl 3-iodo-5,7-dihydrofuro[3,4-f]indole-1-carboxylate (PubChem CID 176913514) has the molecular formula C15H16INO3 and a molecular weight of 385.20 g/mol. Its IUPAC name is tert-butyl 3-iodo-5,7-dihydrofuro[3,4-f]indole-1-carboxylate.
| Compound Name | tert-butyl 3-iodo-5,7-dihydrofuro[3,4-f]indole-1-carboxylate |
|---|---|
| PubChem CID | 176913514 |
| Molecular Formula | C15H16INO3 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | tert-butyl 3-iodo-5,7-dihydrofuro[3,4-f]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(I)c2cc3c(cc21)COC3 |
| InChI | InChI=1S/C15H16INO3/c1-15(2,3)20-14(18)17-6-12(16)11-4-9-7-19-8-10(9)5-13(11)17/h4-6H,7-8H2,1-3H3 |
| InChIKey | AZZIINSCMKVOPF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|